C12H16N4O4 — CID 140867301
2-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid (PubChem CID 140867301) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid.
| Compound Name | 2-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
|---|---|
| PubChem CID | 140867301 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid |
| SMILES | CC(C#N)CC(/N=N/C(C)(C#N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H16N4O4/c1-8(6-13)5-9(11(19)20)15-16-12(2,7-14)4-3-10(17)18/h8-9H,3-5H2,1-2H3,(H,17,18)(H,19,20)/b16-15+ |
| InChIKey | UMLKHVAQRYHIIO-FOCLMDBBSA-N |
| XLogP | 1.59 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|