C16H16Cl6N6O4 — CID 71343257
4-cyano-4-[[2-cyano-5-oxo-5-[(2,2,2-trichloroacetyl)amino]pentan-2-yl]diazenyl]-N-(2,2,2-trichloroacetyl)pentanamide (PubChem CID 71343257) has the molecular formula C16H16Cl6N6O4 and a molecular weight of 569.06 g/mol. Its IUPAC name is 4-cyano-4-[[2-cyano-5-oxo-5-[(2,2,2-trichloroacetyl)amino]pentan-2-yl]diazenyl]-N-(2,2,2-trichloroacetyl)pentanamide.
| Compound Name | 4-cyano-4-[[2-cyano-5-oxo-5-[(2,2,2-trichloroacetyl)amino]pentan-2-yl]diazenyl]-N-(2,2,2-trichloroacetyl)pentanamide |
|---|---|
| PubChem CID | 71343257 |
| Molecular Formula | C16H16Cl6N6O4 |
| Molecular Weight | 569.06 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | 4-cyano-4-[[2-cyano-5-oxo-5-[(2,2,2-trichloroacetyl)amino]pentan-2-yl]diazenyl]-N-(2,2,2-trichloroacetyl)pentanamide |
| SMILES | CC(C#N)(CCC(=O)NC(=O)C(Cl)(Cl)Cl)/N=N/C(C)(C#N)CCC(=O)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H16Cl6N6O4/c1-13(7-23,5-3-9(29)25-11(31)15(17,18)19)27-28-14(2,8-24)6-4-10(30)26-12(32)16(20,21)22/h3-6H2,1-2H3,(H,25,29,31)(H,26,30,32)/b28-27+ |
| InChIKey | YZAXCWPKOONQFX-BYYHNAKLSA-N |
| XLogP | 3.59 |
| TPSA | 164.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.06 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|