C7H8Cl3NO4 — CID 12575227
ethyl 3-oxo-3-[(2,2,2-trichloroacetyl)amino]propanoate (PubChem CID 12575227) has the molecular formula C7H8Cl3NO4 and a molecular weight of 276.50 g/mol. Its IUPAC name is ethyl 3-oxo-3-[(2,2,2-trichloroacetyl)amino]propanoate.
| Compound Name | ethyl 3-oxo-3-[(2,2,2-trichloroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 12575227 |
| Molecular Formula | C7H8Cl3NO4 |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | ethyl 3-oxo-3-[(2,2,2-trichloroacetyl)amino]propanoate |
| SMILES | CCOC(=O)CC(=O)NC(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl3NO4/c1-2-15-5(13)3-4(12)11-6(14)7(8,9)10/h2-3H2,1H3,(H,11,12,14) |
| InChIKey | DLLFALLESHEGCI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|