C10H12Cl3NO5 — CID 91976326
1-O-ethyl 4-O-methyl (E)-3-methyl-2-[(2,2,2-trichloroacetyl)amino]but-2-enedioate (PubChem CID 91976326) has the molecular formula C10H12Cl3NO5 and a molecular weight of 332.57 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (E)-3-methyl-2-[(2,2,2-trichloroacetyl)amino]but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-methyl (E)-3-methyl-2-[(2,2,2-trichloroacetyl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 91976326 |
| Molecular Formula | C10H12Cl3NO5 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 330.98 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (E)-3-methyl-2-[(2,2,2-trichloroacetyl)amino]but-2-enedioate |
| SMILES | CCOC(=O)/C(NC(=O)C(Cl)(Cl)Cl)=C(/C)C(=O)OC |
| InChI | InChI=1S/C10H12Cl3NO5/c1-4-19-8(16)6(5(2)7(15)18-3)14-9(17)10(11,12)13/h4H2,1-3H3,(H,14,17)/b6-5+ |
| InChIKey | IEQXBZRJSJIJFI-AATRIKPKSA-N |
| XLogP | 1.48 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|