About ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane
ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane (PubChem CID 160765452) has the molecular formula C14H25NO5
and a molecular weight of 287.36 g/mol. Its IUPAC name is ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane.
Molecular Properties
| Compound Name | ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane |
| PubChem CID | 160765452 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane |
| SMILES | C.CCOC(=O)CC(=O)N/C(C)=C(/CC)C(=O)OCC |
| InChI | InChI=1S/C13H21NO5.CH4/c1-5-10(13(17)19-7-3)9(4)14-11(15)8-12(16)18-6-2;/h5-8H2,1-4H3,(H,14,15);1H4/b10-9-; |
| InChIKey | RYPXXMQUNMEVHF-KVVVOXFISA-N |
| XLogP | 1.94 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane?
The IUPAC name of ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane (CID 160765452) is ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane.
What is the SMILES notation for ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane?
The canonical SMILES for ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane is C.CCOC(=O)CC(=O)N/C(C)=C(/CC)C(=O)OCC.
What is the InChIKey of ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane?
The InChIKey is RYPXXMQUNMEVHF-KVVVOXFISA-N. The full InChI is InChI=1S/C13H21NO5.CH4/c1-5-10(13(17)19-7-3)9(4)14-11(15)8-12(16)18-6-2;/h5-8H2,1-4H3,(H,14,15);1H4/b10-9-;.
What are the key properties of ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane?
ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane has a molecular weight of 287.36 g/mol, XLogP of 1.94, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-3-[(3-ethoxy-3-oxopropanoyl)amino]-2-ethylbut-2-enoate;methane is sourced from PubChem (CID 160765452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).