C18H30O4 — CID 101172123
diethyl (2E,4E)-2,3,4,5-tetraethylhexa-2,4-dienedioate (PubChem CID 101172123) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is diethyl (2E,4E)-2,3,4,5-tetraethylhexa-2,4-dienedioate.
| Compound Name | diethyl (2E,4E)-2,3,4,5-tetraethylhexa-2,4-dienedioate |
|---|---|
| PubChem CID | 101172123 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | diethyl (2E,4E)-2,3,4,5-tetraethylhexa-2,4-dienedioate |
| SMILES | CCOC(=O)/C(CC)=C(CC)/C(CC)=C(\CC)C(=O)OCC |
| InChI | InChI=1S/C18H30O4/c1-7-13(15(9-3)17(19)21-11-5)14(8-2)16(10-4)18(20)22-12-6/h7-12H2,1-6H3/b15-13+,16-14+ |
| InChIKey | CUKMPQWCLKVQHB-WXUKJITCSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|