C12H18Cl2N4O4 — CID 141256752
4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid;dihydrochloride (PubChem CID 141256752) has the molecular formula C12H18Cl2N4O4 and a molecular weight of 353.21 g/mol. Its IUPAC name is 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid;dihydrochloride.
| Compound Name | 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 141256752 |
| Molecular Formula | C12H18Cl2N4O4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 4-[(4-carboxy-2-cyanobutan-2-yl)diazenyl]-4-cyanopentanoic acid;dihydrochloride |
| SMILES | CC(C#N)(CCC(=O)O)/N=N/C(C)(C#N)CCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C12H16N4O4.2ClH/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20;;/h3-6H2,1-2H3,(H,17,18)(H,19,20);2*1H/b16-15+;; |
| InChIKey | OANGQOBQUCCAAE-VRZXRVJBSA-N |
| XLogP | 2.58 |
| TPSA | 146.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|