C13H19N5O2 — CID 167208165
4-cyano-4-[(2-cyano-5-oxohexan-2-yl)diazenyl]pentanamide (PubChem CID 167208165) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 4-cyano-4-[(2-cyano-5-oxohexan-2-yl)diazenyl]pentanamide.
| Compound Name | 4-cyano-4-[(2-cyano-5-oxohexan-2-yl)diazenyl]pentanamide |
|---|---|
| PubChem CID | 167208165 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-cyano-4-[(2-cyano-5-oxohexan-2-yl)diazenyl]pentanamide |
| SMILES | CC(=O)CCC(C)(C#N)/N=N/C(C)(C#N)CCC(N)=O |
| InChI | InChI=1S/C13H19N5O2/c1-10(19)4-6-12(2,8-14)17-18-13(3,9-15)7-5-11(16)20/h4-7H2,1-3H3,(H2,16,20)/b18-17+ |
| InChIKey | NFHUEZXNQKLDHO-ISLYRVAYSA-N |
| XLogP | 1.64 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|