C40H62N8O12 — CID 87157374
1-ethoxyethyl 4-cyano-4-[[2-cyano-5-[1-[4-[1-[4-cyano-4-[[2-cyano-5-(1-ethoxyethoxy)-5-oxopentan-2-yl]diazenyl]pentanoyl]oxyethoxy]butoxy]ethoxy]-5-oxopentan-2-yl]diazenyl]pentanoate (PubChem CID 87157374) has the molecular formula C40H62N8O12 and a molecular weight of 846.98 g/mol. Its IUPAC name is 1-ethoxyethyl 4-cyano-4-[[2-cyano-5-[1-[4-[1-[4-cyano-4-[[2-cyano-5-(1-ethoxyethoxy)-5-oxopentan-2-yl]diazenyl]pentanoyl]oxyethoxy]butoxy]ethoxy]-5-oxopentan-2-yl]diazenyl]pentanoate.
| Compound Name | 1-ethoxyethyl 4-cyano-4-[[2-cyano-5-[1-[4-[1-[4-cyano-4-[[2-cyano-5-(1-ethoxyethoxy)-5-oxopentan-2-yl]diazenyl]pentanoyl]oxyethoxy]butoxy]ethoxy]-5-oxopentan-2-yl]diazenyl]pentanoate |
|---|---|
| PubChem CID | 87157374 |
| Molecular Formula | C40H62N8O12 |
| Molecular Weight | 846.98 g/mol |
| Exact Mass | 846.45 |
| IUPAC Name | 1-ethoxyethyl 4-cyano-4-[[2-cyano-5-[1-[4-[1-[4-cyano-4-[[2-cyano-5-(1-ethoxyethoxy)-5-oxopentan-2-yl]diazenyl]pentanoyl]oxyethoxy]butoxy]ethoxy]-5-oxopentan-2-yl]diazenyl]pentanoate |
| SMILES | CCOC(C)OC(=O)CCC(C)(C#N)/N=N/C(C)(C#N)CCC(=O)OC(C)OCCCCOC(C)OC(=O)CCC(C)(C#N)/N=N/C(C)(C#N)CCC(=O)OC(C)OCC |
| InChI | InChI=1S/C40H62N8O12/c1-11-53-29(3)57-33(49)15-19-37(7,25-41)45-47-39(9,27-43)21-17-35(51)59-31(5)55-23-13-14-24-56-32(6)60-36(52)18-22-40(10,28-44)48-46-38(8,26-42)20-16-34(50)58-30(4)54-12-2/h29-32H,11-24H2,1-10H3/b47-45+,48-46+ |
| InChIKey | JUHBEULULAJRHE-MLGMXDONSA-N |
| XLogP | 6.58 |
| TPSA | 286.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|