C20H34N2O6P2 — CID 88884330
1-[4-[1-(4-cyano-4-phosphanylpentanoyl)oxyethoxy]butoxy]ethyl 4-cyano-4-phosphanylpentanoate (PubChem CID 88884330) has the molecular formula C20H34N2O6P2 and a molecular weight of 460.45 g/mol. Its IUPAC name is 1-[4-[1-(4-cyano-4-phosphanylpentanoyl)oxyethoxy]butoxy]ethyl 4-cyano-4-phosphanylpentanoate.
| Compound Name | 1-[4-[1-(4-cyano-4-phosphanylpentanoyl)oxyethoxy]butoxy]ethyl 4-cyano-4-phosphanylpentanoate |
|---|---|
| PubChem CID | 88884330 |
| Molecular Formula | C20H34N2O6P2 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[4-[1-(4-cyano-4-phosphanylpentanoyl)oxyethoxy]butoxy]ethyl 4-cyano-4-phosphanylpentanoate |
| SMILES | CC(OCCCCOC(C)OC(=O)CCC(C)(P)C#N)OC(=O)CCC(C)(P)C#N |
| InChI | InChI=1S/C20H34N2O6P2/c1-15(27-17(23)7-9-19(3,29)13-21)25-11-5-6-12-26-16(2)28-18(24)8-10-20(4,30)14-22/h15-16H,5-12,29-30H2,1-4H3 |
| InChIKey | UTWADBZKYPXFIO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|