C13H26O3 — CID 123325340
(1-methoxy-2,2-dimethylpropyl) 4,4-dimethylpentanoate (PubChem CID 123325340) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (1-methoxy-2,2-dimethylpropyl) 4,4-dimethylpentanoate.
| Compound Name | (1-methoxy-2,2-dimethylpropyl) 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 123325340 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (1-methoxy-2,2-dimethylpropyl) 4,4-dimethylpentanoate |
| SMILES | COC(OC(=O)CCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3/c1-12(2,3)9-8-10(14)16-11(15-7)13(4,5)6/h11H,8-9H2,1-7H3 |
| InChIKey | YOOUDCKDRJYNJC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|