C19H36O6 — CID 59687798
1-[3-[1-(2,2-dimethylbutanoyloxy)ethoxy]propoxy]ethyl 2,2-dimethylbutanoate (PubChem CID 59687798) has the molecular formula C19H36O6 and a molecular weight of 360.49 g/mol. Its IUPAC name is 1-[3-[1-(2,2-dimethylbutanoyloxy)ethoxy]propoxy]ethyl 2,2-dimethylbutanoate.
| Compound Name | 1-[3-[1-(2,2-dimethylbutanoyloxy)ethoxy]propoxy]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59687798 |
| Molecular Formula | C19H36O6 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | 1-[3-[1-(2,2-dimethylbutanoyloxy)ethoxy]propoxy]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)OCCCOC(C)OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C19H36O6/c1-9-18(5,6)16(20)24-14(3)22-12-11-13-23-15(4)25-17(21)19(7,8)10-2/h14-15H,9-13H2,1-8H3 |
| InChIKey | ZMJDMHRGINLPNS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|