C23H36O3 — CID 58807719
1-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylmethoxy)ethyl 2,2-dimethylbutanoate (PubChem CID 58807719) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylmethoxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | 1-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylmethoxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58807719 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 1-(1-pentacyclo[7.3.1.14,12.02,7.06,11]tetradecanylmethoxy)ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C)OCC12CC3CC4C5CC(CC41)CC2C5C3 |
| InChI | InChI=1S/C23H36O3/c1-5-22(3,4)21(24)26-13(2)25-12-23-11-15-7-17-16-6-14(9-19(17)23)10-20(23)18(16)8-15/h13-20H,5-12H2,1-4H3 |
| InChIKey | RCXXOUKMZIKOBD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|