About 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate
4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate (PubChem CID 22090266) has the molecular formula C22H36O5
and a molecular weight of 380.53 g/mol. Its IUPAC name is 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate.
Molecular Properties
| Compound Name | 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate |
| PubChem CID | 22090266 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate |
| SMILES | CCOC(C)OC(=O)C(C)(CC)CC(=O)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H36O5/c1-5-21(4,20(24)27-15(3)25-6-2)13-19(23)26-14-22-10-16-7-17(11-22)9-18(8-16)12-22/h15-18H,5-14H2,1-4H3 |
| InChIKey | UGQVIZMSHCVSFG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate?
The IUPAC name of 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate (CID 22090266) is 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate.
What is the SMILES notation for 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate?
The canonical SMILES for 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate is CCOC(C)OC(=O)C(C)(CC)CC(=O)OCC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate?
The InChIKey is UGQVIZMSHCVSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H36O5/c1-5-21(4,20(24)27-15(3)25-6-2)13-19(23)26-14-22-10-16-7-17(11-22)9-18(8-16)12-22/h15-18H,5-14H2,1-4H3.
What are the key properties of 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate?
4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate has a molecular weight of 380.53 g/mol, XLogP of 4.48, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(1-adamantylmethyl) 1-O-(1-ethoxyethyl) 2-ethyl-2-methylbutanedioate is sourced from PubChem (CID 22090266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).