C23H38N2O4 — CID 118257808
3-(4-cyano-4,5,5-trimethylhexanoyl)oxypropyl 4-cyano-4,5,5-trimethylhexanoate (PubChem CID 118257808) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is 3-(4-cyano-4,5,5-trimethylhexanoyl)oxypropyl 4-cyano-4,5,5-trimethylhexanoate.
| Compound Name | 3-(4-cyano-4,5,5-trimethylhexanoyl)oxypropyl 4-cyano-4,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 118257808 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | 3-(4-cyano-4,5,5-trimethylhexanoyl)oxypropyl 4-cyano-4,5,5-trimethylhexanoate |
| SMILES | CC(C)(C)C(C)(C#N)CCC(=O)OCCCOC(=O)CCC(C)(C#N)C(C)(C)C |
| InChI | InChI=1S/C23H38N2O4/c1-20(2,3)22(7,16-24)12-10-18(26)28-14-9-15-29-19(27)11-13-23(8,17-25)21(4,5)6/h9-15H2,1-8H3 |
| InChIKey | WRNQVXUVMAPAPG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|