About 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate
3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate (PubChem CID 90429365) has the molecular formula C18H25NO4
and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate.
Molecular Properties
| Compound Name | 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate |
| PubChem CID | 90429365 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate |
| SMILES | CC(C)(C#N)CCC(=O)OCCCc1ccc(CO)cc1CO |
| InChI | InChI=1S/C18H25NO4/c1-18(2,13-19)8-7-17(22)23-9-3-4-15-6-5-14(11-20)10-16(15)12-21/h5-6,10,20-21H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | DOGPZEJGCVVYSR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate?
The IUPAC name of 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate (CID 90429365) is 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate.
What is the SMILES notation for 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate?
The canonical SMILES for 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate is CC(C)(C#N)CCC(=O)OCCCc1ccc(CO)cc1CO.
What is the InChIKey of 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate?
The InChIKey is DOGPZEJGCVVYSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO4/c1-18(2,13-19)8-7-17(22)23-9-3-4-15-6-5-14(11-20)10-16(15)12-21/h5-6,10,20-21H,3-4,7-9,11-12H2,1-2H3.
What are the key properties of 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate?
3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate has a molecular weight of 319.40 g/mol, XLogP of 2.48, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate is sourced from PubChem (CID 90429365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).