C18H25NO4 — CID 90429365
3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate (PubChem CID 90429365) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate.
| Compound Name | 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate |
|---|---|
| PubChem CID | 90429365 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 3-[2,4-bis(hydroxymethyl)phenyl]propyl 4-cyano-4-methylpentanoate |
| SMILES | CC(C)(C#N)CCC(=O)OCCCc1ccc(CO)cc1CO |
| InChI | InChI=1S/C18H25NO4/c1-18(2,13-19)8-7-17(22)23-9-3-4-15-6-5-14(11-20)10-16(15)12-21/h5-6,10,20-21H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | DOGPZEJGCVVYSR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|