C47H85NO5 — CID 169030195
nonyl 8-[[8-[2-(3,4-dihexylphenyl)ethoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 169030195) has the molecular formula C47H85NO5 and a molecular weight of 744.20 g/mol. Its IUPAC name is nonyl 8-[[8-[2-(3,4-dihexylphenyl)ethoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | nonyl 8-[[8-[2-(3,4-dihexylphenyl)ethoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 169030195 |
| Molecular Formula | C47H85NO5 |
| Molecular Weight | 744.20 g/mol |
| Exact Mass | 743.64 |
| IUPAC Name | nonyl 8-[[8-[2-(3,4-dihexylphenyl)ethoxy]-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)OCCc1ccc(CCCCCC)c(CCCCCC)c1 |
| InChI | InChI=1S/C47H85NO5/c1-4-7-10-13-14-21-28-40-52-46(50)31-24-17-15-19-26-36-48(38-39-49)37-27-20-16-18-25-32-47(51)53-41-35-43-33-34-44(29-22-11-8-5-2)45(42-43)30-23-12-9-6-3/h33-34,42,49H,4-32,35-41H2,1-3H3 |
| InChIKey | CVZUTSKZBNEOEK-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.20 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|