C44H79NO5 — CID 139538582
nonyl 8-[[8-(3-hexyl-4-pentylphenoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate (PubChem CID 139538582) has the molecular formula C44H79NO5 and a molecular weight of 702.12 g/mol. Its IUPAC name is nonyl 8-[[8-(3-hexyl-4-pentylphenoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate.
| Compound Name | nonyl 8-[[8-(3-hexyl-4-pentylphenoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
|---|---|
| PubChem CID | 139538582 |
| Molecular Formula | C44H79NO5 |
| Molecular Weight | 702.12 g/mol |
| Exact Mass | 701.60 |
| IUPAC Name | nonyl 8-[[8-(3-hexyl-4-pentylphenoxy)-8-oxooctyl]-(2-hydroxyethyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCC(=O)Oc1ccc(CCCCC)c(CCCCCC)c1 |
| InChI | InChI=1S/C44H79NO5/c1-4-7-10-12-13-20-27-38-49-43(47)30-23-16-14-18-25-34-45(36-37-46)35-26-19-15-17-24-31-44(48)50-42-33-32-40(28-21-9-6-3)41(39-42)29-22-11-8-5-2/h32-33,39,46H,4-31,34-38H2,1-3H3 |
| InChIKey | VMSTVYSNZQVQGE-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.12 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|