C40H71NO5 — CID 145405619
(3,4-dipentylphenyl) 9-[2-hydroxyethyl-(8-oxo-8-pentoxyoctyl)amino]nonanoate (PubChem CID 145405619) has the molecular formula C40H71NO5 and a molecular weight of 646.01 g/mol. Its IUPAC name is (3,4-dipentylphenyl) 9-[2-hydroxyethyl-(8-oxo-8-pentoxyoctyl)amino]nonanoate.
| Compound Name | (3,4-dipentylphenyl) 9-[2-hydroxyethyl-(8-oxo-8-pentoxyoctyl)amino]nonanoate |
|---|---|
| PubChem CID | 145405619 |
| Molecular Formula | C40H71NO5 |
| Molecular Weight | 646.01 g/mol |
| Exact Mass | 645.53 |
| IUPAC Name | (3,4-dipentylphenyl) 9-[2-hydroxyethyl-(8-oxo-8-pentoxyoctyl)amino]nonanoate |
| SMILES | CCCCCOC(=O)CCCCCCCN(CCO)CCCCCCCCC(=O)Oc1ccc(CCCCC)c(CCCCC)c1 |
| InChI | InChI=1S/C40H71NO5/c1-4-7-17-24-36-28-29-38(35-37(36)25-18-8-5-2)46-40(44)27-20-13-10-11-15-21-30-41(32-33-42)31-22-16-12-14-19-26-39(43)45-34-23-9-6-3/h28-29,35,42H,4-27,30-34H2,1-3H3 |
| InChIKey | YRUQFKICTHBOEZ-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.01 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|