C28H46N2O4 — CID 176723362
[(Z)-8-(4-cyano-4,5,5-trimethylhexanoyl)oxyoct-4-enyl] 4-cyano-4,5,5-trimethylhexanoate (PubChem CID 176723362) has the molecular formula C28H46N2O4 and a molecular weight of 474.69 g/mol. Its IUPAC name is [(Z)-8-(4-cyano-4,5,5-trimethylhexanoyl)oxyoct-4-enyl] 4-cyano-4,5,5-trimethylhexanoate.
| Compound Name | [(Z)-8-(4-cyano-4,5,5-trimethylhexanoyl)oxyoct-4-enyl] 4-cyano-4,5,5-trimethylhexanoate |
|---|---|
| PubChem CID | 176723362 |
| Molecular Formula | C28H46N2O4 |
| Molecular Weight | 474.69 g/mol |
| Exact Mass | 474.35 |
| IUPAC Name | [(Z)-8-(4-cyano-4,5,5-trimethylhexanoyl)oxyoct-4-enyl] 4-cyano-4,5,5-trimethylhexanoate |
| SMILES | CC(C)(C)C(C)(C#N)CCC(=O)OCCC/C=C\CCCOC(=O)CCC(C)(C#N)C(C)(C)C |
| InChI | InChI=1S/C28H46N2O4/c1-25(2,3)27(7,21-29)17-15-23(31)33-19-13-11-9-10-12-14-20-34-24(32)16-18-28(8,22-30)26(4,5)6/h9-10H,11-20H2,1-8H3/b10-9- |
| InChIKey | RFESNJXOINHKFI-KTKRTIGZSA-N |
| XLogP | 6.90 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|