C20H38O2S2 — CID 176740520
6-[[(Z)-hept-4-enyl]disulfanyl]hexyl 4,4-dimethylpentanoate (PubChem CID 176740520) has the molecular formula C20H38O2S2 and a molecular weight of 374.66 g/mol. Its IUPAC name is 6-[[(Z)-hept-4-enyl]disulfanyl]hexyl 4,4-dimethylpentanoate.
| Compound Name | 6-[[(Z)-hept-4-enyl]disulfanyl]hexyl 4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 176740520 |
| Molecular Formula | C20H38O2S2 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 6-[[(Z)-hept-4-enyl]disulfanyl]hexyl 4,4-dimethylpentanoate |
| SMILES | CC/C=C\CCCSSCCCCCCOC(=O)CCC(C)(C)C |
| InChI | InChI=1S/C20H38O2S2/c1-5-6-7-9-12-17-23-24-18-13-10-8-11-16-22-19(21)14-15-20(2,3)4/h6-7H,5,8-18H2,1-4H3/b7-6- |
| InChIKey | OXTPRSSLAZMXBX-SREVYHEPSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|