C22H40Cl2N4O4Si2 — CID 59772181
3-[chloro(dimethyl)silyl]propyl 4-[[5-[3-[chloro(dimethyl)silyl]propoxy]-2-cyano-5-hydroxypentan-2-yl]diazenyl]-4-cyanopentanoate (PubChem CID 59772181) has the molecular formula C22H40Cl2N4O4Si2 and a molecular weight of 551.66 g/mol. Its IUPAC name is 3-[chloro(dimethyl)silyl]propyl 4-[[5-[3-[chloro(dimethyl)silyl]propoxy]-2-cyano-5-hydroxypentan-2-yl]diazenyl]-4-cyanopentanoate.
| Compound Name | 3-[chloro(dimethyl)silyl]propyl 4-[[5-[3-[chloro(dimethyl)silyl]propoxy]-2-cyano-5-hydroxypentan-2-yl]diazenyl]-4-cyanopentanoate |
|---|---|
| PubChem CID | 59772181 |
| Molecular Formula | C22H40Cl2N4O4Si2 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 3-[chloro(dimethyl)silyl]propyl 4-[[5-[3-[chloro(dimethyl)silyl]propoxy]-2-cyano-5-hydroxypentan-2-yl]diazenyl]-4-cyanopentanoate |
| SMILES | CC(C#N)(CCC(=O)OCCC[Si](C)(C)Cl)/N=N/C(C)(C#N)CCC(O)OCCC[Si](C)(C)Cl |
| InChI | InChI=1S/C22H40Cl2N4O4Si2/c1-21(17-25,11-9-19(29)31-13-7-15-33(3,4)23)27-28-22(2,18-26)12-10-20(30)32-14-8-16-34(5,6)24/h19,29H,7-16H2,1-6H3/b28-27+ |
| InChIKey | OZVHTZPMWGLKGG-BYYHNAKLSA-N |
| XLogP | 6.11 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|