C38H79N3O8Si4 — CID 140732053
2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 4-[[5-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methyl-5-oxopentan-2-yl]diazenyl]-4-cyanopentanoate (PubChem CID 140732053) has the molecular formula C38H79N3O8Si4 and a molecular weight of 818.41 g/mol. Its IUPAC name is 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 4-[[5-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methyl-5-oxopentan-2-yl]diazenyl]-4-cyanopentanoate.
| Compound Name | 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 4-[[5-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methyl-5-oxopentan-2-yl]diazenyl]-4-cyanopentanoate |
|---|---|
| PubChem CID | 140732053 |
| Molecular Formula | C38H79N3O8Si4 |
| Molecular Weight | 818.41 g/mol |
| Exact Mass | 817.49 |
| IUPAC Name | 2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethyl 4-[[5-[2-[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propoxy]ethoxy]-2-methyl-5-oxopentan-2-yl]diazenyl]-4-cyanopentanoate |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCOCCOC(=O)CCC(C)(C)/N=N/C(C)(C#N)CCC(=O)OCCOCCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C38H79N3O8Si4/c1-14-16-30-50(6,7)48-52(10,11)32-18-24-44-26-28-46-35(42)20-22-37(3,4)40-41-38(5,34-39)23-21-36(43)47-29-27-45-25-19-33-53(12,13)49-51(8,9)31-17-15-2/h14-33H2,1-13H3/b41-40+ |
| InChIKey | HPWVRIRTEQLJNU-CDJCAARLSA-N |
| XLogP | 10.41 |
| TPSA | 138.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.41 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|