C38H32N4O8 — CID 22756223
[2-(2-hydroxybenzoyl)phenyl] 4-cyano-4-[[2-cyano-5-[2-(2-hydroxybenzoyl)phenoxy]-5-oxopentan-2-yl]diazenyl]pentanoate (PubChem CID 22756223) has the molecular formula C38H32N4O8 and a molecular weight of 672.69 g/mol. Its IUPAC name is [2-(2-hydroxybenzoyl)phenyl] 4-cyano-4-[[2-cyano-5-[2-(2-hydroxybenzoyl)phenoxy]-5-oxopentan-2-yl]diazenyl]pentanoate.
| Compound Name | [2-(2-hydroxybenzoyl)phenyl] 4-cyano-4-[[2-cyano-5-[2-(2-hydroxybenzoyl)phenoxy]-5-oxopentan-2-yl]diazenyl]pentanoate |
|---|---|
| PubChem CID | 22756223 |
| Molecular Formula | C38H32N4O8 |
| Molecular Weight | 672.69 g/mol |
| Exact Mass | 672.22 |
| IUPAC Name | [2-(2-hydroxybenzoyl)phenyl] 4-cyano-4-[[2-cyano-5-[2-(2-hydroxybenzoyl)phenoxy]-5-oxopentan-2-yl]diazenyl]pentanoate |
| SMILES | CC(C#N)(CCC(=O)Oc1ccccc1C(=O)c1ccccc1O)/N=N/C(C)(C#N)CCC(=O)Oc1ccccc1C(=O)c1ccccc1O |
| InChI | InChI=1S/C38H32N4O8/c1-37(23-39,21-19-33(45)49-31-17-9-5-13-27(31)35(47)25-11-3-7-15-29(25)43)41-42-38(2,24-40)22-20-34(46)50-32-18-10-6-14-28(32)36(48)26-12-4-8-16-30(26)44/h3-18,43-44H,19-22H2,1-2H3/b42-41+ |
| InChIKey | CLIZVCMPBQNPKH-WQVHNPAPSA-N |
| XLogP | 6.65 |
| TPSA | 199.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|