C9H14N2 — CID 15584321
2,6-dimethylheptanedinitrile (PubChem CID 15584321) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2,6-dimethylheptanedinitrile.
| Compound Name | 2,6-dimethylheptanedinitrile |
|---|---|
| PubChem CID | 15584321 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2,6-dimethylheptanedinitrile |
| SMILES | CC(C#N)CCCC(C)C#N |
| InChI | InChI=1S/C9H14N2/c1-8(6-10)4-3-5-9(2)7-11/h8-9H,3-5H2,1-2H3 |
| InChIKey | IERAUDYEBKFNFZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |