C13H19N3 — CID 122418902
1,3-dimethyloctane-1,3,7-tricarbonitrile (PubChem CID 122418902) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1,3-dimethyloctane-1,3,7-tricarbonitrile.
| Compound Name | 1,3-dimethyloctane-1,3,7-tricarbonitrile |
|---|---|
| PubChem CID | 122418902 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1,3-dimethyloctane-1,3,7-tricarbonitrile |
| SMILES | CC(C#N)CCCC(C)(C#N)CC(C)C#N |
| InChI | InChI=1S/C13H19N3/c1-11(8-14)5-4-6-13(3,10-16)7-12(2)9-15/h11-12H,4-7H2,1-3H3 |
| InChIKey | RMBBZCFIENSHJC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |