About sodium 2-methylbutanenitrile
sodium 2-methylbutanenitrile (PubChem CID 23346888) has the molecular formula C5H9NNa+
and a molecular weight of 106.12 g/mol. Its IUPAC name is sodium 2-methylbutanenitrile.
Molecular Properties
| Compound Name | sodium 2-methylbutanenitrile |
| PubChem CID | 23346888 |
| Molecular Formula | C5H9NNa+ |
| Molecular Weight | 106.12 g/mol |
| Exact Mass | 106.06 |
| IUPAC Name | sodium 2-methylbutanenitrile |
| SMILES | CCC(C)C#N.[Na+] |
| InChI | InChI=1S/C5H9N.Na/c1-3-5(2)4-6;/h5H,3H2,1-2H3;/q;+1 |
| InChIKey | NMJUGJZOWYXIHN-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.12 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium 2-methylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methylbutanenitrile?
The IUPAC name of sodium 2-methylbutanenitrile (CID 23346888) is sodium 2-methylbutanenitrile.
What is the SMILES notation for sodium 2-methylbutanenitrile?
The canonical SMILES for sodium 2-methylbutanenitrile is CCC(C)C#N.[Na+].
What is the InChIKey of sodium 2-methylbutanenitrile?
The InChIKey is NMJUGJZOWYXIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N.Na/c1-3-5(2)4-6;/h5H,3H2,1-2H3;/q;+1.
What are the key properties of sodium 2-methylbutanenitrile?
sodium 2-methylbutanenitrile has a molecular weight of 106.12 g/mol, XLogP of -1.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methylbutanenitrile is sourced from PubChem (CID 23346888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).