C11H22O2 — CID 87291206
3-methoxy-5,7-dimethyloctan-2-one (PubChem CID 87291206) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-methoxy-5,7-dimethyloctan-2-one.
| Compound Name | 3-methoxy-5,7-dimethyloctan-2-one |
|---|---|
| PubChem CID | 87291206 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-methoxy-5,7-dimethyloctan-2-one |
| SMILES | COC(CC(C)CC(C)C)C(C)=O |
| InChI | InChI=1S/C11H22O2/c1-8(2)6-9(3)7-11(13-5)10(4)12/h8-9,11H,6-7H2,1-5H3 |
| InChIKey | XTYQAHIIMFLAKQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |