C24H40O6 — CID 159455035
3-methoxybutan-2-one;3-methoxy-5-methylhexan-2-one;3-methoxy-4-phenylbutan-2-one (PubChem CID 159455035) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is 3-methoxybutan-2-one;3-methoxy-5-methylhexan-2-one;3-methoxy-4-phenylbutan-2-one.
| Compound Name | 3-methoxybutan-2-one;3-methoxy-5-methylhexan-2-one;3-methoxy-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 159455035 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 3-methoxybutan-2-one;3-methoxy-5-methylhexan-2-one;3-methoxy-4-phenylbutan-2-one |
| SMILES | COC(C)C(C)=O.COC(CC(C)C)C(C)=O.COC(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C11H14O2.C8H16O2.C5H10O2/c1-9(12)11(13-2)8-10-6-4-3-5-7-10;1-6(2)5-8(10-4)7(3)9;1-4(6)5(2)7-3/h3-7,11H,8H2,1-2H3;6,8H,5H2,1-4H3;5H,1-3H3 |
| InChIKey | LTVYQAFMAIKHLY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |