C18H20O2 — CID 50994790
2-methoxy-1,5-diphenylpentan-3-one (PubChem CID 50994790) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-methoxy-1,5-diphenylpentan-3-one.
| Compound Name | 2-methoxy-1,5-diphenylpentan-3-one |
|---|---|
| PubChem CID | 50994790 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-methoxy-1,5-diphenylpentan-3-one |
| SMILES | COC(Cc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-20-18(14-16-10-6-3-7-11-16)17(19)13-12-15-8-4-2-5-9-15/h2-11,18H,12-14H2,1H3 |
| InChIKey | RWMPVEKBKLSIRV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |