C17H18O2 — CID 14469744
2-hydroxy-1,5-diphenylpentan-3-one (PubChem CID 14469744) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-hydroxy-1,5-diphenylpentan-3-one.
| Compound Name | 2-hydroxy-1,5-diphenylpentan-3-one |
|---|---|
| PubChem CID | 14469744 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-hydroxy-1,5-diphenylpentan-3-one |
| SMILES | O=C(CCc1ccccc1)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H18O2/c18-16(12-11-14-7-3-1-4-8-14)17(19)13-15-9-5-2-6-10-15/h1-10,17,19H,11-13H2 |
| InChIKey | RHYFFNVUZXSTRZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |