C13H26O3 — CID 57241983
2,6,8-trimethylnonan-4-yl hydrogen carbonate (PubChem CID 57241983) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,6,8-trimethylnonan-4-yl hydrogen carbonate.
| Compound Name | 2,6,8-trimethylnonan-4-yl hydrogen carbonate |
|---|---|
| PubChem CID | 57241983 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2,6,8-trimethylnonan-4-yl hydrogen carbonate |
| SMILES | CC(C)CC(C)CC(CC(C)C)OC(=O)O |
| InChI | InChI=1S/C13H26O3/c1-9(2)6-11(5)8-12(7-10(3)4)16-13(14)15/h9-12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | TVTVGHLVIJPBAV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |