About 2,6,8-trimethylnonan-4-yl hydrogen carbonate
2,6,8-trimethylnonan-4-yl hydrogen carbonate (PubChem CID 57241983) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2,6,8-trimethylnonan-4-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 2,6,8-trimethylnonan-4-yl hydrogen carbonate |
| PubChem CID | 57241983 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 2,6,8-trimethylnonan-4-yl hydrogen carbonate |
| SMILES | CC(C)CC(C)CC(CC(C)C)OC(=O)O |
| InChI | InChI=1S/C13H26O3/c1-9(2)6-11(5)8-12(7-10(3)4)16-13(14)15/h9-12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | TVTVGHLVIJPBAV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6,8-trimethylnonan-4-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,8-trimethylnonan-4-yl hydrogen carbonate?
The IUPAC name of 2,6,8-trimethylnonan-4-yl hydrogen carbonate (CID 57241983) is 2,6,8-trimethylnonan-4-yl hydrogen carbonate.
What is the SMILES notation for 2,6,8-trimethylnonan-4-yl hydrogen carbonate?
The canonical SMILES for 2,6,8-trimethylnonan-4-yl hydrogen carbonate is CC(C)CC(C)CC(CC(C)C)OC(=O)O.
What is the InChIKey of 2,6,8-trimethylnonan-4-yl hydrogen carbonate?
The InChIKey is TVTVGHLVIJPBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-9(2)6-11(5)8-12(7-10(3)4)16-13(14)15/h9-12H,6-8H2,1-5H3,(H,14,15).
What are the key properties of 2,6,8-trimethylnonan-4-yl hydrogen carbonate?
2,6,8-trimethylnonan-4-yl hydrogen carbonate has a molecular weight of 230.35 g/mol, XLogP of 4.17, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,8-trimethylnonan-4-yl hydrogen carbonate is sourced from PubChem (CID 57241983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).