C13H26O4 — CID 18314287
(4-ethyl-2,2-dimethyloctan-3-yl) hydroxy carbonate (PubChem CID 18314287) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is (4-ethyl-2,2-dimethyloctan-3-yl) hydroxy carbonate.
| Compound Name | (4-ethyl-2,2-dimethyloctan-3-yl) hydroxy carbonate |
|---|---|
| PubChem CID | 18314287 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | (4-ethyl-2,2-dimethyloctan-3-yl) hydroxy carbonate |
| SMILES | CCCCC(CC)C(OC(=O)OO)C(C)(C)C |
| InChI | InChI=1S/C13H26O4/c1-6-8-9-10(7-2)11(13(3,4)5)16-12(14)17-15/h10-11,15H,6-9H2,1-5H3 |
| InChIKey | YWHMJMBYBJBHKE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|