About 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane
4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane (PubChem CID 146258320) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane.
Molecular Properties
| Compound Name | 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane |
| PubChem CID | 146258320 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane |
| SMILES | CCCCC(CC)C(CN=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-6-8-9-11(7-2)12(10-14-15)13(3,4)5/h11-12H,6-10H2,1-5H3 |
| InChIKey | KZJXOGUOAFXNAK-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane?
The IUPAC name of 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane (CID 146258320) is 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane.
What is the SMILES notation for 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane?
The canonical SMILES for 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane is CCCCC(CC)C(CN=O)C(C)(C)C.
What is the InChIKey of 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane?
The InChIKey is KZJXOGUOAFXNAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-6-8-9-11(7-2)12(10-14-15)13(3,4)5/h11-12H,6-10H2,1-5H3.
What are the key properties of 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane?
4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane has a molecular weight of 213.36 g/mol, XLogP of 4.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2,2-dimethyl-3-(nitrosomethyl)octane is sourced from PubChem (CID 146258320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).