About 3-(dibromomethyl)heptane
3-(dibromomethyl)heptane (PubChem CID 87164380) has the molecular formula C8H16Br2
and a molecular weight of 272.02 g/mol. Its IUPAC name is 3-(dibromomethyl)heptane.
Molecular Properties
| Compound Name | 3-(dibromomethyl)heptane |
| PubChem CID | 87164380 |
| Molecular Formula | C8H16Br2 |
| Molecular Weight | 272.02 g/mol |
| Exact Mass | 269.96 |
| IUPAC Name | 3-(dibromomethyl)heptane |
| SMILES | CCCCC(CC)C(Br)Br |
| InChI | InChI=1S/C8H16Br2/c1-3-5-6-7(4-2)8(9)10/h7-8H,3-6H2,1-2H3 |
| InChIKey | QESAIJWUSZXATE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibromomethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibromomethyl)heptane?
The IUPAC name of 3-(dibromomethyl)heptane (CID 87164380) is 3-(dibromomethyl)heptane.
What is the SMILES notation for 3-(dibromomethyl)heptane?
The canonical SMILES for 3-(dibromomethyl)heptane is CCCCC(CC)C(Br)Br.
What is the InChIKey of 3-(dibromomethyl)heptane?
The InChIKey is QESAIJWUSZXATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16Br2/c1-3-5-6-7(4-2)8(9)10/h7-8H,3-6H2,1-2H3.
What are the key properties of 3-(dibromomethyl)heptane?
3-(dibromomethyl)heptane has a molecular weight of 272.02 g/mol, XLogP of 4.32, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibromomethyl)heptane is sourced from PubChem (CID 87164380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).