C17H38N2 — CID 57146972
5,9-diethyltridecane-6,8-diamine (PubChem CID 57146972) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 5,9-diethyltridecane-6,8-diamine.
| Compound Name | 5,9-diethyltridecane-6,8-diamine |
|---|---|
| PubChem CID | 57146972 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 5,9-diethyltridecane-6,8-diamine |
| SMILES | CCCCC(CC)C(N)CC(N)C(CC)CCCC |
| InChI | InChI=1S/C17H38N2/c1-5-9-11-14(7-3)16(18)13-17(19)15(8-4)12-10-6-2/h14-17H,5-13,18-19H2,1-4H3 |
| InChIKey | QNEZYOVKHJNGGR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |