C23H50N2 — CID 15610190
5,15-diethylnonadecane-5,14-diamine (PubChem CID 15610190) has the molecular formula C23H50N2 and a molecular weight of 354.67 g/mol. Its IUPAC name is 5,15-diethylnonadecane-5,14-diamine.
| Compound Name | 5,15-diethylnonadecane-5,14-diamine |
|---|---|
| PubChem CID | 15610190 |
| Molecular Formula | C23H50N2 |
| Molecular Weight | 354.67 g/mol |
| Exact Mass | 354.40 |
| IUPAC Name | 5,15-diethylnonadecane-5,14-diamine |
| SMILES | CCCCC(CC)C(N)CCCCCCCCC(N)(CC)CCCC |
| InChI | InChI=1S/C23H50N2/c1-5-9-17-21(7-3)22(24)18-15-13-11-12-14-16-20-23(25,8-4)19-10-6-2/h21-22H,5-20,24-25H2,1-4H3 |
| InChIKey | GUQYMSYVDBHHCR-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.67 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|