About 13-ethylhexadecane-1,12-diamine
13-ethylhexadecane-1,12-diamine (PubChem CID 151701600) has the molecular formula C18H40N2
and a molecular weight of 284.53 g/mol. Its IUPAC name is 13-ethylhexadecane-1,12-diamine.
Molecular Properties
| Compound Name | 13-ethylhexadecane-1,12-diamine |
| PubChem CID | 151701600 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | 13-ethylhexadecane-1,12-diamine |
| SMILES | CCCC(CC)C(N)CCCCCCCCCCCN |
| InChI | InChI=1S/C18H40N2/c1-3-14-17(4-2)18(20)15-12-10-8-6-5-7-9-11-13-16-19/h17-18H,3-16,19-20H2,1-2H3 |
| InChIKey | RESGTRPQRAEFNN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 13-ethylhexadecane-1,12-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-ethylhexadecane-1,12-diamine?
The IUPAC name of 13-ethylhexadecane-1,12-diamine (CID 151701600) is 13-ethylhexadecane-1,12-diamine.
What is the SMILES notation for 13-ethylhexadecane-1,12-diamine?
The canonical SMILES for 13-ethylhexadecane-1,12-diamine is CCCC(CC)C(N)CCCCCCCCCCCN.
What is the InChIKey of 13-ethylhexadecane-1,12-diamine?
The InChIKey is RESGTRPQRAEFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H40N2/c1-3-14-17(4-2)18(20)15-12-10-8-6-5-7-9-11-13-16-19/h17-18H,3-16,19-20H2,1-2H3.
What are the key properties of 13-ethylhexadecane-1,12-diamine?
13-ethylhexadecane-1,12-diamine has a molecular weight of 284.53 g/mol, XLogP of 5.00, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 13-ethylhexadecane-1,12-diamine is sourced from PubChem (CID 151701600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).