C8H13BrO3 — CID 20681290
3-(bromomethoxy)-4-methylhexane-2,5-dione (PubChem CID 20681290) has the molecular formula C8H13BrO3 and a molecular weight of 237.09 g/mol. Its IUPAC name is 3-(bromomethoxy)-4-methylhexane-2,5-dione.
| Compound Name | 3-(bromomethoxy)-4-methylhexane-2,5-dione |
|---|---|
| PubChem CID | 20681290 |
| Molecular Formula | C8H13BrO3 |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 3-(bromomethoxy)-4-methylhexane-2,5-dione |
| SMILES | CC(=O)C(C)C(OCBr)C(C)=O |
| InChI | InChI=1S/C8H13BrO3/c1-5(6(2)10)8(7(3)11)12-4-9/h5,8H,4H2,1-3H3 |
| InChIKey | ZJBABSAHEWEJCO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|