C9H18O3 — CID 59320466
2,4-dimethylpentan-3-yl methyl carbonate (PubChem CID 59320466) has the molecular formula C9H18O3 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl methyl carbonate.
| Compound Name | 2,4-dimethylpentan-3-yl methyl carbonate |
|---|---|
| PubChem CID | 59320466 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 2,4-dimethylpentan-3-yl methyl carbonate |
| SMILES | COC(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C9H18O3/c1-6(2)8(7(3)4)12-9(10)11-5/h6-8H,1-5H3 |
| InChIKey | WROGMUGPNJJLRW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |