About dimethyl carbonate;ethane
dimethyl carbonate;ethane (PubChem CID 160632176) has the molecular formula C5H12O3
and a molecular weight of 120.15 g/mol. Its IUPAC name is dimethyl carbonate;ethane.
Molecular Properties
| Compound Name | dimethyl carbonate;ethane |
| PubChem CID | 160632176 |
| Molecular Formula | C5H12O3 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | dimethyl carbonate;ethane |
| SMILES | CC.COC(=O)OC |
| InChI | InChI=1S/C3H6O3.C2H6/c1-5-3(4)6-2;1-2/h1-2H3;1-2H3 |
| InChIKey | RIBBPNGPTYNENK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dimethyl carbonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;ethane?
The IUPAC name of dimethyl carbonate;ethane (CID 160632176) is dimethyl carbonate;ethane.
What is the SMILES notation for dimethyl carbonate;ethane?
The canonical SMILES for dimethyl carbonate;ethane is CC.COC(=O)OC.
What is the InChIKey of dimethyl carbonate;ethane?
The InChIKey is RIBBPNGPTYNENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H6/c1-5-3(4)6-2;1-2/h1-2H3;1-2H3.
What are the key properties of dimethyl carbonate;ethane?
dimethyl carbonate;ethane has a molecular weight of 120.15 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;ethane is sourced from PubChem (CID 160632176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).