About dimethyl carbonate;ethane-1,2-diol;ethene
dimethyl carbonate;ethane-1,2-diol;ethene (PubChem CID 173368401) has the molecular formula C15H32O5
and a molecular weight of 292.42 g/mol. Its IUPAC name is dimethyl carbonate;ethane-1,2-diol;ethene.
Molecular Properties
| Compound Name | dimethyl carbonate;ethane-1,2-diol;ethene |
| PubChem CID | 173368401 |
| Molecular Formula | C15H32O5 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | dimethyl carbonate;ethane-1,2-diol;ethene |
| SMILES | C=C.C=C.C=C.C=C.C=C.COC(=O)OC.OCCO |
| InChI | InChI=1S/C3H6O3.C2H6O2.5C2H4/c1-5-3(4)6-2;3-1-2-4;5*1-2/h1-2H3;3-4H,1-2H2;5*1-2H2 |
| InChIKey | URUBYTARABGIFN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl carbonate;ethane-1,2-diol;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl carbonate;ethane-1,2-diol;ethene?
The IUPAC name of dimethyl carbonate;ethane-1,2-diol;ethene (CID 173368401) is dimethyl carbonate;ethane-1,2-diol;ethene.
What is the SMILES notation for dimethyl carbonate;ethane-1,2-diol;ethene?
The canonical SMILES for dimethyl carbonate;ethane-1,2-diol;ethene is C=C.C=C.C=C.C=C.C=C.COC(=O)OC.OCCO.
What is the InChIKey of dimethyl carbonate;ethane-1,2-diol;ethene?
The InChIKey is URUBYTARABGIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O3.C2H6O2.5C2H4/c1-5-3(4)6-2;3-1-2-4;5*1-2/h1-2H3;3-4H,1-2H2;5*1-2H2.
What are the key properties of dimethyl carbonate;ethane-1,2-diol;ethene?
dimethyl carbonate;ethane-1,2-diol;ethene has a molecular weight of 292.42 g/mol, XLogP of 3.38, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl carbonate;ethane-1,2-diol;ethene is sourced from PubChem (CID 173368401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).