methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate

C10H19NO4 — CID 134568233

IUPACmethyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate
SMILESCOC(=O)N[C@H](C(C)=O)[C@@H](OC)C(C)C
InChIInChI=1S/C10H19NO4/c1-6(2)9(14-4)8(7(3)12)11-10(13)15-5/h6,8-9H,1-5H3,(H,11,13)/t8-,9+/m1/s1
InChIKeyGMCKRTCFHOXENB-BDAKNGLRSA-N
MW217.26 g/mol
LogP0.97
Rot. Bonds5

About methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate

methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate (PubChem CID 134568233) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate.

Molecular Properties

Compound Namemethyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate
PubChem CID134568233
Molecular FormulaC10H19NO4
Molecular Weight217.26 g/mol
Exact Mass217.13
IUPAC Namemethyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate
SMILESCOC(=O)N[C@H](C(C)=O)[C@@H](OC)C(C)C
InChIInChI=1S/C10H19NO4/c1-6(2)9(14-4)8(7(3)12)11-10(13)15-5/h6,8-9H,1-5H3,(H,11,13)/t8-,9+/m1/s1
InChIKeyGMCKRTCFHOXENB-BDAKNGLRSA-N
XLogP0.97
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500217.26
LogP ≤ 50.97
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate?
The IUPAC name of methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate (CID 134568233) is methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate.
What is the SMILES notation for methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate?
The canonical SMILES for methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate is COC(=O)N[C@H](C(C)=O)[C@@H](OC)C(C)C.
What is the InChIKey of methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate?
The InChIKey is GMCKRTCFHOXENB-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H19NO4/c1-6(2)9(14-4)8(7(3)12)11-10(13)15-5/h6,8-9H,1-5H3,(H,11,13)/t8-,9+/m1/s1.
What are the key properties of methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate?
methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate has a molecular weight of 217.26 g/mol, XLogP of 0.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(3S,4S)-4-methoxy-5-methyl-2-oxohexan-3-yl]carbamate is sourced from PubChem (CID 134568233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).