C9H16N2O5 — CID 141273313
methyl N-[2-(methoxycarbonylamino)-3-methylbutanoyl]carbamate (PubChem CID 141273313) has the molecular formula C9H16N2O5 and a molecular weight of 232.24 g/mol. Its IUPAC name is methyl N-[2-(methoxycarbonylamino)-3-methylbutanoyl]carbamate.
| Compound Name | methyl N-[2-(methoxycarbonylamino)-3-methylbutanoyl]carbamate |
|---|---|
| PubChem CID | 141273313 |
| Molecular Formula | C9H16N2O5 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | methyl N-[2-(methoxycarbonylamino)-3-methylbutanoyl]carbamate |
| SMILES | COC(=O)NC(=O)C(NC(=O)OC)C(C)C |
| InChI | InChI=1S/C9H16N2O5/c1-5(2)6(10-8(13)15-3)7(12)11-9(14)16-4/h5-6H,1-4H3,(H,10,13)(H,11,12,14) |
| InChIKey | LGLDCETXTWBQSN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |