About 1-chloro-1-fluoroethane;dichloromethane;methanol
1-chloro-1-fluoroethane;dichloromethane;methanol (PubChem CID 174297915) has the molecular formula C4H10Cl3FO
and a molecular weight of 199.48 g/mol. Its IUPAC name is 1-chloro-1-fluoroethane;dichloromethane;methanol.
Molecular Properties
| Compound Name | 1-chloro-1-fluoroethane;dichloromethane;methanol |
| PubChem CID | 174297915 |
| Molecular Formula | C4H10Cl3FO |
| Molecular Weight | 199.48 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 1-chloro-1-fluoroethane;dichloromethane;methanol |
| SMILES | CC(F)Cl.CO.ClCCl |
| InChI | InChI=1S/C2H4ClF.CH2Cl2.CH4O/c1-2(3)4;2-1-3;1-2/h2H,1H3;1H2;2H,1H3 |
| InChIKey | ZFQZEZXZLDYKBQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1-fluoroethane;dichloromethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1-fluoroethane;dichloromethane;methanol?
The IUPAC name of 1-chloro-1-fluoroethane;dichloromethane;methanol (CID 174297915) is 1-chloro-1-fluoroethane;dichloromethane;methanol.
What is the SMILES notation for 1-chloro-1-fluoroethane;dichloromethane;methanol?
The canonical SMILES for 1-chloro-1-fluoroethane;dichloromethane;methanol is CC(F)Cl.CO.ClCCl.
What is the InChIKey of 1-chloro-1-fluoroethane;dichloromethane;methanol?
The InChIKey is ZFQZEZXZLDYKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClF.CH2Cl2.CH4O/c1-2(3)4;2-1-3;1-2/h2H,1H3;1H2;2H,1H3.
What are the key properties of 1-chloro-1-fluoroethane;dichloromethane;methanol?
1-chloro-1-fluoroethane;dichloromethane;methanol has a molecular weight of 199.48 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1-fluoroethane;dichloromethane;methanol is sourced from PubChem (CID 174297915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).