C6H12ClNO — CID 122577405
(1Z,2S)-N-hydroxy-2,3-dimethylbutanimidoyl chloride (PubChem CID 122577405) has the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. Its IUPAC name is (1Z,2S)-N-hydroxy-2,3-dimethylbutanimidoyl chloride.
| Compound Name | (1Z,2S)-N-hydroxy-2,3-dimethylbutanimidoyl chloride |
|---|---|
| PubChem CID | 122577405 |
| Molecular Formula | C6H12ClNO |
| Molecular Weight | 149.62 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | (1Z,2S)-N-hydroxy-2,3-dimethylbutanimidoyl chloride |
| SMILES | CC(C)[C@H](C)/C(Cl)=N/O |
| InChI | InChI=1S/C6H12ClNO/c1-4(2)5(3)6(7)8-9/h4-5,9H,1-3H3/b8-6-/t5-/m0/s1 |
| InChIKey | UYNFBZUALXWKHO-JCVXODEMSA-N |
| XLogP | 2.31 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|