2-ethyl-N-hydroxybut-3-ynimidoyl chloride

C6H8ClNO — CID 175535486

IUPAC2-ethyl-N-hydroxybut-3-ynimidoyl chloride
SMILESC#CC(CC)C(Cl)=NO
InChIInChI=1S/C6H8ClNO/c1-3-5(4-2)6(7)8-9/h1,5,9H,4H2,2H3
InChIKeySBUMXBMTEOUDBD-UHFFFAOYSA-N
MW145.59 g/mol
LogP1.67
Rot. Bonds2

About 2-ethyl-N-hydroxybut-3-ynimidoyl chloride

2-ethyl-N-hydroxybut-3-ynimidoyl chloride (PubChem CID 175535486) has the molecular formula C6H8ClNO and a molecular weight of 145.59 g/mol. Its IUPAC name is 2-ethyl-N-hydroxybut-3-ynimidoyl chloride.

Molecular Properties

Compound Name2-ethyl-N-hydroxybut-3-ynimidoyl chloride
PubChem CID175535486
Molecular FormulaC6H8ClNO
Molecular Weight145.59 g/mol
Exact Mass145.03
IUPAC Name2-ethyl-N-hydroxybut-3-ynimidoyl chloride
SMILESC#CC(CC)C(Cl)=NO
InChIInChI=1S/C6H8ClNO/c1-3-5(4-2)6(7)8-9/h1,5,9H,4H2,2H3
InChIKeySBUMXBMTEOUDBD-UHFFFAOYSA-N
XLogP1.67
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.59
LogP ≤ 51.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-ethyl-N-hydroxybut-3-ynimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-N-hydroxybut-3-ynimidoyl chloride?
The IUPAC name of 2-ethyl-N-hydroxybut-3-ynimidoyl chloride (CID 175535486) is 2-ethyl-N-hydroxybut-3-ynimidoyl chloride.
What is the SMILES notation for 2-ethyl-N-hydroxybut-3-ynimidoyl chloride?
The canonical SMILES for 2-ethyl-N-hydroxybut-3-ynimidoyl chloride is C#CC(CC)C(Cl)=NO.
What is the InChIKey of 2-ethyl-N-hydroxybut-3-ynimidoyl chloride?
The InChIKey is SBUMXBMTEOUDBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNO/c1-3-5(4-2)6(7)8-9/h1,5,9H,4H2,2H3.
What are the key properties of 2-ethyl-N-hydroxybut-3-ynimidoyl chloride?
2-ethyl-N-hydroxybut-3-ynimidoyl chloride has a molecular weight of 145.59 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-hydroxybut-3-ynimidoyl chloride is sourced from PubChem (CID 175535486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).