2-ethyl-N-hydroxybutanimidoyl chloride

C6H12ClNO — CID 72760486

IUPAC2-ethyl-N-hydroxybutanimidoyl chloride
SMILESCCC(CC)C(Cl)=NO
InChIInChI=1S/C6H12ClNO/c1-3-5(4-2)6(7)8-9/h5,9H,3-4H2,1-2H3
InChIKeySNOZJPWYXUHYKF-UHFFFAOYSA-N
MW149.62 g/mol
LogP2.45
Rot. Bonds3

About 2-ethyl-N-hydroxybutanimidoyl chloride

2-ethyl-N-hydroxybutanimidoyl chloride (PubChem CID 72760486) has the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. Its IUPAC name is 2-ethyl-N-hydroxybutanimidoyl chloride.

Molecular Properties

Compound Name2-ethyl-N-hydroxybutanimidoyl chloride
PubChem CID72760486
Molecular FormulaC6H12ClNO
Molecular Weight149.62 g/mol
Exact Mass149.06
IUPAC Name2-ethyl-N-hydroxybutanimidoyl chloride
SMILESCCC(CC)C(Cl)=NO
InChIInChI=1S/C6H12ClNO/c1-3-5(4-2)6(7)8-9/h5,9H,3-4H2,1-2H3
InChIKeySNOZJPWYXUHYKF-UHFFFAOYSA-N
XLogP2.45
TPSA32.59 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500149.62
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-ethyl-N-hydroxybutanimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-N-hydroxybutanimidoyl chloride?
The IUPAC name of 2-ethyl-N-hydroxybutanimidoyl chloride (CID 72760486) is 2-ethyl-N-hydroxybutanimidoyl chloride.
What is the SMILES notation for 2-ethyl-N-hydroxybutanimidoyl chloride?
The canonical SMILES for 2-ethyl-N-hydroxybutanimidoyl chloride is CCC(CC)C(Cl)=NO.
What is the InChIKey of 2-ethyl-N-hydroxybutanimidoyl chloride?
The InChIKey is SNOZJPWYXUHYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO/c1-3-5(4-2)6(7)8-9/h5,9H,3-4H2,1-2H3.
What are the key properties of 2-ethyl-N-hydroxybutanimidoyl chloride?
2-ethyl-N-hydroxybutanimidoyl chloride has a molecular weight of 149.62 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-hydroxybutanimidoyl chloride is sourced from PubChem (CID 72760486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).