About 5-bromo-2-ethylpentanoyl chloride
5-bromo-2-ethylpentanoyl chloride (PubChem CID 15591710) has the molecular formula C7H12BrClO
and a molecular weight of 227.53 g/mol. Its IUPAC name is 5-bromo-2-ethylpentanoyl chloride.
Molecular Properties
| Compound Name | 5-bromo-2-ethylpentanoyl chloride |
| PubChem CID | 15591710 |
| Molecular Formula | C7H12BrClO |
| Molecular Weight | 227.53 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 5-bromo-2-ethylpentanoyl chloride |
| SMILES | CCC(CCCBr)C(=O)Cl |
| InChI | InChI=1S/C7H12BrClO/c1-2-6(7(9)10)4-3-5-8/h6H,2-5H2,1H3 |
| InChIKey | UISQANPFBBLTLR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-ethylpentanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-ethylpentanoyl chloride?
The IUPAC name of 5-bromo-2-ethylpentanoyl chloride (CID 15591710) is 5-bromo-2-ethylpentanoyl chloride.
What is the SMILES notation for 5-bromo-2-ethylpentanoyl chloride?
The canonical SMILES for 5-bromo-2-ethylpentanoyl chloride is CCC(CCCBr)C(=O)Cl.
What is the InChIKey of 5-bromo-2-ethylpentanoyl chloride?
The InChIKey is UISQANPFBBLTLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12BrClO/c1-2-6(7(9)10)4-3-5-8/h6H,2-5H2,1H3.
What are the key properties of 5-bromo-2-ethylpentanoyl chloride?
5-bromo-2-ethylpentanoyl chloride has a molecular weight of 227.53 g/mol, XLogP of 2.95, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-ethylpentanoyl chloride is sourced from PubChem (CID 15591710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).