C12H23NO — CID 155125097
(NZ)-N-(5-ethyl-2,3,3-trimethylhept-1-en-4-ylidene)hydroxylamine (PubChem CID 155125097) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (NZ)-N-(5-ethyl-2,3,3-trimethylhept-1-en-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(5-ethyl-2,3,3-trimethylhept-1-en-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 155125097 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (NZ)-N-(5-ethyl-2,3,3-trimethylhept-1-en-4-ylidene)hydroxylamine |
| SMILES | C=C(C)C(C)(C)/C(=N\O)C(CC)CC |
| InChI | InChI=1S/C12H23NO/c1-7-10(8-2)11(13-14)12(5,6)9(3)4/h10,14H,3,7-8H2,1-2,4-6H3/b13-11- |
| InChIKey | SRBGZKKBGSMRDR-QBFSEMIESA-N |
| XLogP | 3.86 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|